C16H22O5 — CID 19764531
2-methyl-3-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propanoic acid (PubChem CID 19764531) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-methyl-3-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propanoic acid.
| Compound Name | 2-methyl-3-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 19764531 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-methyl-3-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]propanoic acid |
| SMILES | CC(Cc1ccc(OCC(=O)OC(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C16H22O5/c1-11(15(18)19)9-12-5-7-13(8-6-12)20-10-14(17)21-16(2,3)4/h5-8,11H,9-10H2,1-4H3,(H,18,19) |
| InChIKey | RRBWPDFCWJFDTP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |