C21H33NO5 — CID 163650444
tert-butyl 2-[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]acetate (PubChem CID 163650444) has the molecular formula C21H33NO5 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl 2-[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]acetate |
|---|---|
| PubChem CID | 163650444 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | tert-butyl 2-[4-[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]phenoxy]acetate |
| SMILES | CC[C@H](Cc1ccc(OCC(=O)OC(C)(C)C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO5/c1-8-16(22-19(24)27-21(5,6)7)13-15-9-11-17(12-10-15)25-14-18(23)26-20(2,3)4/h9-12,16H,8,13-14H2,1-7H3,(H,22,24)/t16-/m1/s1 |
| InChIKey | SSLHVSSCOHAHFZ-MRXNPFEDSA-N |
| XLogP | 4.25 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |