ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid

C15H24O3 — CID 144819636

IUPACethane;2-methyl-3-(4-propoxyphenyl)propanoic acid
SMILESCC.CCCOc1ccc(CC(C)C(=O)O)cc1
InChIInChI=1S/C13H18O3.C2H6/c1-3-8-16-12-6-4-11(5-7-12)9-10(2)13(14)15;1-2/h4-7,10H,3,8-9H2,1-2H3,(H,14,15);1-2H3
InChIKeyBUYWIIFTLAWZFM-UHFFFAOYSA-N
MW252.35 g/mol
LogP3.76
Rot. Bonds6

About ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid

ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid (PubChem CID 144819636) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid.

Molecular Properties

Compound Nameethane;2-methyl-3-(4-propoxyphenyl)propanoic acid
PubChem CID144819636
Molecular FormulaC15H24O3
Molecular Weight252.35 g/mol
Exact Mass252.17
IUPAC Nameethane;2-methyl-3-(4-propoxyphenyl)propanoic acid
SMILESCC.CCCOc1ccc(CC(C)C(=O)O)cc1
InChIInChI=1S/C13H18O3.C2H6/c1-3-8-16-12-6-4-11(5-7-12)9-10(2)13(14)15;1-2/h4-7,10H,3,8-9H2,1-2H3,(H,14,15);1-2H3
InChIKeyBUYWIIFTLAWZFM-UHFFFAOYSA-N
XLogP3.76
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.35
LogP ≤ 53.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid?
The IUPAC name of ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid (CID 144819636) is ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid.
What is the SMILES notation for ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid?
The canonical SMILES for ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid is CC.CCCOc1ccc(CC(C)C(=O)O)cc1.
What is the InChIKey of ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid?
The InChIKey is BUYWIIFTLAWZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3.C2H6/c1-3-8-16-12-6-4-11(5-7-12)9-10(2)13(14)15;1-2/h4-7,10H,3,8-9H2,1-2H3,(H,14,15);1-2H3.
What are the key properties of ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid?
ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid has a molecular weight of 252.35 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-3-(4-propoxyphenyl)propanoic acid is sourced from PubChem (CID 144819636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).