C22H27F3O4 — CID 142194124
ethane;2-methyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid (PubChem CID 142194124) has the molecular formula C22H27F3O4 and a molecular weight of 412.45 g/mol. Its IUPAC name is ethane;2-methyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid.
| Compound Name | ethane;2-methyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142194124 |
| Molecular Formula | C22H27F3O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | ethane;2-methyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid |
| SMILES | CC.CC(Cc1ccc(OCCCOc2cccc(C(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H21F3O4.C2H6/c1-14(19(24)25)12-15-6-8-17(9-7-15)26-10-3-11-27-18-5-2-4-16(13-18)20(21,22)23;1-2/h2,4-9,13-14H,3,10-12H2,1H3,(H,24,25);1-2H3 |
| InChIKey | FJFIYCOZXGFUEJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|