C24H29F3O4 — CID 142194055
2-cyclopropyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid;ethane (PubChem CID 142194055) has the molecular formula C24H29F3O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-cyclopropyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid;ethane.
| Compound Name | 2-cyclopropyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 142194055 |
| Molecular Formula | C24H29F3O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-cyclopropyl-3-[4-[3-[3-(trifluoromethyl)phenoxy]propoxy]phenyl]propanoic acid;ethane |
| SMILES | CC.O=C(O)C(Cc1ccc(OCCCOc2cccc(C(F)(F)F)c2)cc1)C1CC1 |
| InChI | InChI=1S/C22H23F3O4.C2H6/c23-22(24,25)17-3-1-4-19(14-17)29-12-2-11-28-18-9-5-15(6-10-18)13-20(21(26)27)16-7-8-16;1-2/h1,3-6,9-10,14,16,20H,2,7-8,11-13H2,(H,26,27);1-2H3 |
| InChIKey | DIWZZFQYKYCXIR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|