C15H20F3NO3 — CID 122120229
2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenoxy]propyl]amino]propanoic acid (PubChem CID 122120229) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenoxy]propyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenoxy]propyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122120229 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 2-methyl-3-[methyl-[3-[3-(trifluoromethyl)phenoxy]propyl]amino]propanoic acid |
| SMILES | CC(CN(C)CCCOc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C15H20F3NO3/c1-11(14(20)21)10-19(2)7-4-8-22-13-6-3-5-12(9-13)15(16,17)18/h3,5-6,9,11H,4,7-8,10H2,1-2H3,(H,20,21) |
| InChIKey | PGBULYYIWGQHQG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|