C16H20F3NO3 — CID 119228005
2-methyl-3-[methyl-[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid (PubChem CID 119228005) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119228005 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-methyl-3-[methyl-[2-methyl-2-[3-(trifluoromethyl)phenyl]propanoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)C(C)(C)c1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C16H20F3NO3/c1-10(13(21)22)9-20(4)14(23)15(2,3)11-6-5-7-12(8-11)16(17,18)19/h5-8,10H,9H2,1-4H3,(H,21,22) |
| InChIKey | RDPNPTXSTCVHTF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |