C14H17F3O3 — CID 62397829
3-hydroxy-2-propan-2-yl-3-[3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 62397829) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-hydroxy-2-propan-2-yl-3-[3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 3-hydroxy-2-propan-2-yl-3-[3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 62397829 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-hydroxy-2-propan-2-yl-3-[3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | CC(C)C(C(=O)O)C(C)(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3O3/c1-8(2)11(12(18)19)13(3,20)9-5-4-6-10(7-9)14(15,16)17/h4-8,11,20H,1-3H3,(H,18,19) |
| InChIKey | SAXWDEDKYNEDGE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |