C13H16F3NO2 — CID 115050963
2-amino-2,3-dimethyl-3-[3-(trifluoromethyl)phenyl]butanoic acid (PubChem CID 115050963) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-amino-2,3-dimethyl-3-[3-(trifluoromethyl)phenyl]butanoic acid.
| Compound Name | 2-amino-2,3-dimethyl-3-[3-(trifluoromethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 115050963 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-amino-2,3-dimethyl-3-[3-(trifluoromethyl)phenyl]butanoic acid |
| SMILES | CC(N)(C(=O)O)C(C)(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO2/c1-11(2,12(3,17)10(18)19)8-5-4-6-9(7-8)13(14,15)16/h4-7H,17H2,1-3H3,(H,18,19) |
| InChIKey | RRLBKGGDTCWKAV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |