C12H15ClF3NO2 — CID 69068250
2-(aminomethyl)-2-[3-(trifluoromethyl)phenyl]butanoic acid;hydrochloride (PubChem CID 69068250) has the molecular formula C12H15ClF3NO2 and a molecular weight of 297.70 g/mol. Its IUPAC name is 2-(aminomethyl)-2-[3-(trifluoromethyl)phenyl]butanoic acid;hydrochloride.
| Compound Name | 2-(aminomethyl)-2-[3-(trifluoromethyl)phenyl]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 69068250 |
| Molecular Formula | C12H15ClF3NO2 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-(aminomethyl)-2-[3-(trifluoromethyl)phenyl]butanoic acid;hydrochloride |
| SMILES | CCC(CN)(C(=O)O)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H14F3NO2.ClH/c1-2-11(7-16,10(17)18)8-4-3-5-9(6-8)12(13,14)15;/h3-6H,2,7,16H2,1H3,(H,17,18);1H |
| InChIKey | SXBYUUIRYAACLT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |