C14H18F3NO2 — CID 66096075
4-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]hexanoic acid (PubChem CID 66096075) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 4-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]hexanoic acid.
| Compound Name | 4-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 66096075 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-amino-3-methyl-3-[3-(trifluoromethyl)phenyl]hexanoic acid |
| SMILES | CCC(N)C(C)(CC(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO2/c1-3-11(18)13(2,8-12(19)20)9-5-4-6-10(7-9)14(15,16)17/h4-7,11H,3,8,18H2,1-2H3,(H,19,20) |
| InChIKey | JYKKOJMDULZBHJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |