C11H16F3NO — CID 160848796
butan-2-amine;3-(trifluoromethyl)phenol (PubChem CID 160848796) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is butan-2-amine;3-(trifluoromethyl)phenol.
| Compound Name | butan-2-amine;3-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 160848796 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | butan-2-amine;3-(trifluoromethyl)phenol |
| SMILES | CCC(C)N.Oc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C7H5F3O.C4H11N/c8-7(9,10)5-2-1-3-6(11)4-5;1-3-4(2)5/h1-4,11H;4H,3,5H2,1-2H3 |
| InChIKey | SIZJZYAZOZQNEX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |