C15H20F3NO3 — CID 66678385
tert-butyl-[(2R)-1-hydroxy-2-[3-(trifluoromethyl)phenyl]propan-2-yl]carbamic acid (PubChem CID 66678385) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is tert-butyl-[(2R)-1-hydroxy-2-[3-(trifluoromethyl)phenyl]propan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[(2R)-1-hydroxy-2-[3-(trifluoromethyl)phenyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66678385 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | tert-butyl-[(2R)-1-hydroxy-2-[3-(trifluoromethyl)phenyl]propan-2-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@@](C)(CO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO3/c1-13(2,3)19(12(21)22)14(4,9-20)10-6-5-7-11(8-10)15(16,17)18/h5-8,20H,9H2,1-4H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | COOCIAAHKUGTCK-AWEZNQCLSA-N |
| XLogP | 3.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |