C10H11F3O3 — CID 71340400
acetic acid;[3-(trifluoromethyl)phenyl]methanol (PubChem CID 71340400) has the molecular formula C10H11F3O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is acetic acid;[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | acetic acid;[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 71340400 |
| Molecular Formula | C10H11F3O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | acetic acid;[3-(trifluoromethyl)phenyl]methanol |
| SMILES | CC(=O)O.OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H7F3O.C2H4O2/c9-8(10,11)7-3-1-2-6(4-7)5-12;1-2(3)4/h1-4,12H,5H2;1H3,(H,3,4) |
| InChIKey | BIOJKQCLUBKIOW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |