C14H20F3NO3 — CID 23622748
acetic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol (PubChem CID 23622748) has the molecular formula C14H20F3NO3 and a molecular weight of 307.31 g/mol. Its IUPAC name is acetic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol.
| Compound Name | acetic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 23622748 |
| Molecular Formula | C14H20F3NO3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | acetic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol |
| SMILES | CC(=O)O.CC(Cc1cccc(C(F)(F)F)c1)NCCO |
| InChI | InChI=1S/C12H16F3NO.C2H4O2/c1-9(16-5-6-17)7-10-3-2-4-11(8-10)12(13,14)15;1-2(3)4/h2-4,8-9,16-17H,5-7H2,1H3;1H3,(H,3,4) |
| InChIKey | FAZYOGDAUZZDMZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |