C17H25F3N2 — CID 757431
(2S)-N-(2-piperidin-1-ylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 757431) has the molecular formula C17H25F3N2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2S)-N-(2-piperidin-1-ylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | (2S)-N-(2-piperidin-1-ylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 757431 |
| Molecular Formula | C17H25F3N2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (2S)-N-(2-piperidin-1-ylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | C[C@@H](Cc1cccc(C(F)(F)F)c1)NCCN1CCCCC1 |
| InChI | InChI=1S/C17H25F3N2/c1-14(21-8-11-22-9-3-2-4-10-22)12-15-6-5-7-16(13-15)17(18,19)20/h5-7,13-14,21H,2-4,8-12H2,1H3/t14-/m0/s1 |
| InChIKey | IPVAQYBSKJLMME-AWEZNQCLSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |