C13H16ClF3N2 — CID 3046408
3-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride (PubChem CID 3046408) has the molecular formula C13H16ClF3N2 and a molecular weight of 292.73 g/mol. Its IUPAC name is 3-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride.
| Compound Name | 3-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 3046408 |
| Molecular Formula | C13H16ClF3N2 |
| Molecular Weight | 292.73 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)NCCC#N.Cl |
| InChI | InChI=1S/C13H15F3N2.ClH/c1-10(18-7-3-6-17)8-11-4-2-5-12(9-11)13(14,15)16;/h2,4-5,9-10,18H,3,7-8H2,1H3;1H |
| InChIKey | ZVFGJNUWQDFJGV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|