C16H28F3NOS — CID 143236210
ethane;N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydroxysulfanylethane (PubChem CID 143236210) has the molecular formula C16H28F3NOS and a molecular weight of 339.47 g/mol. Its IUPAC name is ethane;N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydroxysulfanylethane.
| Compound Name | ethane;N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydroxysulfanylethane |
|---|---|
| PubChem CID | 143236210 |
| Molecular Formula | C16H28F3NOS |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | ethane;N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;hydroxysulfanylethane |
| SMILES | CC.CCNC(C)Cc1cccc(C(F)(F)F)c1.CCSO |
| InChI | InChI=1S/C12H16F3N.C2H6OS.C2H6/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15;1-2-4-3;1-2/h4-6,8-9,16H,3,7H2,1-2H3;3H,2H2,1H3;1-2H3 |
| InChIKey | OHUCBDCNBCSZPG-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|