C13H18F3NS — CID 65127657
1-ethylsulfanyl-N-methyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 65127657) has the molecular formula C13H18F3NS and a molecular weight of 277.36 g/mol. Its IUPAC name is 1-ethylsulfanyl-N-methyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | 1-ethylsulfanyl-N-methyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 65127657 |
| Molecular Formula | C13H18F3NS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-ethylsulfanyl-N-methyl-3-[3-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | CCSCC(Cc1cccc(C(F)(F)F)c1)NC |
| InChI | InChI=1S/C13H18F3NS/c1-3-18-9-12(17-2)8-10-5-4-6-11(7-10)13(14,15)16/h4-7,12,17H,3,8-9H2,1-2H3 |
| InChIKey | HQLKXABREKHDRR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |