C17H25ClF3N — CID 87555857
N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;2-methylbuta-1,3-diene;hydrochloride (PubChem CID 87555857) has the molecular formula C17H25ClF3N and a molecular weight of 335.84 g/mol. Its IUPAC name is N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;2-methylbuta-1,3-diene;hydrochloride.
| Compound Name | N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;2-methylbuta-1,3-diene;hydrochloride |
|---|---|
| PubChem CID | 87555857 |
| Molecular Formula | C17H25ClF3N |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-ethyl-1-[3-(trifluoromethyl)phenyl]propan-2-amine;2-methylbuta-1,3-diene;hydrochloride |
| SMILES | C=CC(=C)C.CCNC(C)Cc1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H16F3N.C5H8.ClH/c1-3-16-9(2)7-10-5-4-6-11(8-10)12(13,14)15;1-4-5(2)3;/h4-6,8-9,16H,3,7H2,1-2H3;4H,1-2H2,3H3;1H |
| InChIKey | CLAPUTMBQUNZDQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|