C17H24F3NO3 — CID 20838478
3-methylbut-2-enoic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol (PubChem CID 20838478) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is 3-methylbut-2-enoic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol.
| Compound Name | 3-methylbut-2-enoic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 20838478 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-methylbut-2-enoic acid;2-[1-[3-(trifluoromethyl)phenyl]propan-2-ylamino]ethanol |
| SMILES | CC(C)=CC(=O)O.CC(Cc1cccc(C(F)(F)F)c1)NCCO |
| InChI | InChI=1S/C12H16F3NO.C5H8O2/c1-9(16-5-6-17)7-10-3-2-4-11(8-10)12(13,14)15;1-4(2)3-5(6)7/h2-4,8-9,16-17H,5-7H2,1H3;3H,1-2H3,(H,6,7) |
| InChIKey | VBXRZENLJAQPEF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|