C25H26F3NS — CID 10002741
N-(2-benzhydrylsulfanylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 10002741) has the molecular formula C25H26F3NS and a molecular weight of 429.55 g/mol. Its IUPAC name is N-(2-benzhydrylsulfanylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | N-(2-benzhydrylsulfanylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 10002741 |
| Molecular Formula | C25H26F3NS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-(2-benzhydrylsulfanylethyl)-1-[3-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | CC(Cc1cccc(C(F)(F)F)c1)NCCSC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26F3NS/c1-19(17-20-9-8-14-23(18-20)25(26,27)28)29-15-16-30-24(21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-14,18-19,24,29H,15-17H2,1H3 |
| InChIKey | WQCWJUMEEBOQBE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|