C12H14F3NO2 — CID 154512800
N-[(2S)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]propan-2-yl]acetamide (PubChem CID 154512800) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]propan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 154512800 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-[3-(trifluoromethyl)phenyl]propan-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](CO)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO2/c1-8(18)16-11(7-17)6-9-3-2-4-10(5-9)12(13,14)15/h2-5,11,17H,6-7H2,1H3,(H,16,18)/t11-/m0/s1 |
| InChIKey | INLIBEYWFWWYGN-NSHDSACASA-N |
| XLogP | 1.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |