C13H15Cl2F3N2 — CID 172679370
3-[1-[4-chloro-3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride (PubChem CID 172679370) has the molecular formula C13H15Cl2F3N2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride.
| Compound Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 172679370 |
| Molecular Formula | C13H15Cl2F3N2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-[1-[4-chloro-3-(trifluoromethyl)phenyl]propan-2-ylamino]propanenitrile;hydrochloride |
| SMILES | CC(Cc1ccc(Cl)c(C(F)(F)F)c1)NCCC#N.Cl |
| InChI | InChI=1S/C13H14ClF3N2.ClH/c1-9(19-6-2-5-18)7-10-3-4-12(14)11(8-10)13(15,16)17;/h3-4,8-9,19H,2,6-7H2,1H3;1H |
| InChIKey | AENJRRVHWLLHJQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|