C10H9Cl2F3N2 — CID 171260024
(3S)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propanenitrile;hydrochloride (PubChem CID 171260024) has the molecular formula C10H9Cl2F3N2 and a molecular weight of 285.10 g/mol. Its IUPAC name is (3S)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propanenitrile;hydrochloride.
| Compound Name | (3S)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 171260024 |
| Molecular Formula | C10H9Cl2F3N2 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | (3S)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propanenitrile;hydrochloride |
| SMILES | Cl.N#CC[C@H](N)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H8ClF3N2.ClH/c11-8-2-1-6(9(16)3-4-15)5-7(8)10(12,13)14;/h1-2,5,9H,3,16H2;1H/t9-;/m0./s1 |
| InChIKey | LYOACQZNOBSYGI-FVGYRXGTSA-N |
| XLogP | 3.69 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |