C10H12Cl2F3NO — CID 171207674
(3R)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propan-1-ol;hydrochloride (PubChem CID 171207674) has the molecular formula C10H12Cl2F3NO and a molecular weight of 290.11 g/mol. Its IUPAC name is (3R)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propan-1-ol;hydrochloride.
| Compound Name | (3R)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171207674 |
| Molecular Formula | C10H12Cl2F3NO |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | (3R)-3-amino-3-[4-chloro-3-(trifluoromethyl)phenyl]propan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](CCO)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11ClF3NO.ClH/c11-8-2-1-6(9(15)3-4-16)5-7(8)10(12,13)14;/h1-2,5,9,16H,3-4,15H2;1H/t9-;/m1./s1 |
| InChIKey | OYUFAAFXFZOFPE-SBSPUUFOSA-N |
| XLogP | 3.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |