C11H14ClF4NO — CID 171209513
(4R)-4-amino-4-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride (PubChem CID 171209513) has the molecular formula C11H14ClF4NO and a molecular weight of 287.68 g/mol. Its IUPAC name is (4R)-4-amino-4-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride.
| Compound Name | (4R)-4-amino-4-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171209513 |
| Molecular Formula | C11H14ClF4NO |
| Molecular Weight | 287.68 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (4R)-4-amino-4-[3-fluoro-4-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@H](CCCO)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H13F4NO.ClH/c12-9-6-7(10(16)2-1-5-17)3-4-8(9)11(13,14)15;/h3-4,6,10,17H,1-2,5,16H2;1H/t10-;/m1./s1 |
| InChIKey | ZPNLRROYWJULKD-HNCPQSOCSA-N |
| XLogP | 3.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.68 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |