C11H15ClF3NO — CID 171226401
(4S)-4-amino-4-[3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride (PubChem CID 171226401) has the molecular formula C11H15ClF3NO and a molecular weight of 269.69 g/mol. Its IUPAC name is (4S)-4-amino-4-[3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride.
| Compound Name | (4S)-4-amino-4-[3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171226401 |
| Molecular Formula | C11H15ClF3NO |
| Molecular Weight | 269.69 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (4S)-4-amino-4-[3-(trifluoromethyl)phenyl]butan-1-ol;hydrochloride |
| SMILES | Cl.N[C@@H](CCCO)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO.ClH/c12-11(13,14)9-4-1-3-8(7-9)10(15)5-2-6-16;/h1,3-4,7,10,16H,2,5-6,15H2;1H/t10-;/m0./s1 |
| InChIKey | GAMNOHLBBCHRSM-PPHPATTJSA-N |
| XLogP | 2.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.69 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |