C12H17ClF3NO — CID 166520305
2-propan-2-yloxy-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (PubChem CID 166520305) has the molecular formula C12H17ClF3NO and a molecular weight of 283.72 g/mol. Its IUPAC name is 2-propan-2-yloxy-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride.
| Compound Name | 2-propan-2-yloxy-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 166520305 |
| Molecular Formula | C12H17ClF3NO |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-propan-2-yloxy-1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| SMILES | CC(C)OCC(N)c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H16F3NO.ClH/c1-8(2)17-7-11(16)9-4-3-5-10(6-9)12(13,14)15;/h3-6,8,11H,7,16H2,1-2H3;1H |
| InChIKey | WJYVYTZBCHSQRG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |