C12H16F3NS — CID 64634045
2-propan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 64634045) has the molecular formula C12H16F3NS and a molecular weight of 263.33 g/mol. Its IUPAC name is 2-propan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-propan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 64634045 |
| Molecular Formula | C12H16F3NS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-propan-2-ylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(C)SCC(N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H16F3NS/c1-8(2)17-7-11(16)9-4-3-5-10(6-9)12(13,14)15/h3-6,8,11H,7,16H2,1-2H3 |
| InChIKey | CPZXFTUIUJLNBF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |