C13H16F3NO2S — CID 64612931
ethyl 2-[2-amino-2-[3-(trifluoromethyl)phenyl]ethyl]sulfanylacetate (PubChem CID 64612931) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is ethyl 2-[2-amino-2-[3-(trifluoromethyl)phenyl]ethyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-amino-2-[3-(trifluoromethyl)phenyl]ethyl]sulfanylacetate |
|---|---|
| PubChem CID | 64612931 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | ethyl 2-[2-amino-2-[3-(trifluoromethyl)phenyl]ethyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCC(N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NO2S/c1-2-19-12(18)8-20-7-11(17)9-4-3-5-10(6-9)13(14,15)16/h3-6,11H,2,7-8,17H2,1H3 |
| InChIKey | QYHZVHXONDIUHX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |