C11H10BrF3O2 — CID 12717579
ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 12717579) has the molecular formula C11H10BrF3O2 and a molecular weight of 311.10 g/mol. Its IUPAC name is ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 12717579 |
| Molecular Formula | C11H10BrF3O2 |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)C(Br)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10BrF3O2/c1-2-17-10(16)9(12)7-4-3-5-8(6-7)11(13,14)15/h3-6,9H,2H2,1H3 |
| InChIKey | HIGHVWUDDYUWTR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|