C11H12BrF3N2O — CID 70376561
ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]ethanehydrazonate (PubChem CID 70376561) has the molecular formula C11H12BrF3N2O and a molecular weight of 325.13 g/mol. Its IUPAC name is ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]ethanehydrazonate.
| Compound Name | ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]ethanehydrazonate |
|---|---|
| PubChem CID | 70376561 |
| Molecular Formula | C11H12BrF3N2O |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | ethyl 2-bromo-2-[3-(trifluoromethyl)phenyl]ethanehydrazonate |
| SMILES | CCOC(=NN)C(Br)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12BrF3N2O/c1-2-18-10(17-16)9(12)7-4-3-5-8(6-7)11(13,14)15/h3-6,9H,2,16H2,1H3 |
| InChIKey | WBHRTFBSTVVKJR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|