C15H22F3NO — CID 65190191
1-amino-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]hexan-3-ol (PubChem CID 65190191) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-amino-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]hexan-3-ol.
| Compound Name | 1-amino-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]hexan-3-ol |
|---|---|
| PubChem CID | 65190191 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 1-amino-4,4-dimethyl-2-[3-(trifluoromethyl)phenyl]hexan-3-ol |
| SMILES | CCC(C)(C)C(O)C(CN)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H22F3NO/c1-4-14(2,3)13(20)12(9-19)10-6-5-7-11(8-10)15(16,17)18/h5-8,12-13,20H,4,9,19H2,1-3H3 |
| InChIKey | JTUOPQXZSPLPBD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |