C18H25NO — CID 69330267
1-amino-4,4-dimethyl-2-naphthalen-2-ylhexan-3-ol (PubChem CID 69330267) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 1-amino-4,4-dimethyl-2-naphthalen-2-ylhexan-3-ol.
| Compound Name | 1-amino-4,4-dimethyl-2-naphthalen-2-ylhexan-3-ol |
|---|---|
| PubChem CID | 69330267 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1-amino-4,4-dimethyl-2-naphthalen-2-ylhexan-3-ol |
| SMILES | CCC(C)(C)C(O)C(CN)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H25NO/c1-4-18(2,3)17(20)16(12-19)15-10-9-13-7-5-6-8-14(13)11-15/h5-11,16-17,20H,4,12,19H2,1-3H3 |
| InChIKey | MWEYYJHRPKEEMD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |