C18H25NO — CID 20631914
(2S,3R)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol (PubChem CID 20631914) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is (2S,3R)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol.
| Compound Name | (2S,3R)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol |
|---|---|
| PubChem CID | 20631914 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | (2S,3R)-4,4-dimethyl-1-(methylamino)-2-naphthalen-2-ylpentan-3-ol |
| SMILES | CNC[C@H](c1ccc2ccccc2c1)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C18H25NO/c1-18(2,3)17(20)16(12-19-4)15-10-9-13-7-5-6-8-14(13)11-15/h5-11,16-17,19-20H,12H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | NMLVGYJWQMHSCP-IAGOWNOFSA-N |
| XLogP | 3.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |