C20H20ClN — CID 68762237
(2S)-3-chloro-N-methyl-2-naphthalen-2-yl-3-phenylpropan-1-amine (PubChem CID 68762237) has the molecular formula C20H20ClN and a molecular weight of 309.84 g/mol. Its IUPAC name is (2S)-3-chloro-N-methyl-2-naphthalen-2-yl-3-phenylpropan-1-amine.
| Compound Name | (2S)-3-chloro-N-methyl-2-naphthalen-2-yl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 68762237 |
| Molecular Formula | C20H20ClN |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2S)-3-chloro-N-methyl-2-naphthalen-2-yl-3-phenylpropan-1-amine |
| SMILES | CNC[C@H](c1ccc2ccccc2c1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C20H20ClN/c1-22-14-19(20(21)16-8-3-2-4-9-16)18-12-11-15-7-5-6-10-17(15)13-18/h2-13,19-20,22H,14H2,1H3/t19-,20?/m1/s1 |
| InChIKey | LZILTVHXOJJKON-FIWHBWSRSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|