C21H21Cl — CID 153192882
2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene (PubChem CID 153192882) has the molecular formula C21H21Cl and a molecular weight of 308.85 g/mol. Its IUPAC name is 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene.
| Compound Name | 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene |
|---|---|
| PubChem CID | 153192882 |
| Molecular Formula | C21H21Cl |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene |
| SMILES | CCC[C@H](c1ccc2ccccc2c1)[C@@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C21H21Cl/c1-2-8-20(21(22)17-10-4-3-5-11-17)19-14-13-16-9-6-7-12-18(16)15-19/h3-7,9-15,20-21H,2,8H2,1H3/t20-,21+/m1/s1 |
| InChIKey | WIJWDGWOHDJYEX-RTWAWAEBSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|