About 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene
2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene (PubChem CID 153192882) has the molecular formula C21H21Cl
and a molecular weight of 308.85 g/mol. Its IUPAC name is 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene.
Molecular Properties
| Compound Name | 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene |
| PubChem CID | 153192882 |
| Molecular Formula | C21H21Cl |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene |
| SMILES | CCC[C@H](c1ccc2ccccc2c1)[C@@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C21H21Cl/c1-2-8-20(21(22)17-10-4-3-5-11-17)19-14-13-16-9-6-7-12-18(16)15-19/h3-7,9-15,20-21H,2,8H2,1H3/t20-,21+/m1/s1 |
| InChIKey | WIJWDGWOHDJYEX-RTWAWAEBSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene?
The IUPAC name of 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene (CID 153192882) is 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene.
What is the SMILES notation for 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene?
The canonical SMILES for 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene is CCC[C@H](c1ccc2ccccc2c1)[C@@H](Cl)c1ccccc1.
What is the InChIKey of 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene?
The InChIKey is WIJWDGWOHDJYEX-RTWAWAEBSA-N. The full InChI is InChI=1S/C21H21Cl/c1-2-8-20(21(22)17-10-4-3-5-11-17)19-14-13-16-9-6-7-12-18(16)15-19/h3-7,9-15,20-21H,2,8H2,1H3/t20-,21+/m1/s1.
What are the key properties of 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene?
2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene has a molecular weight of 308.85 g/mol, XLogP of 6.70, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,2R)-1-chloro-1-phenylpentan-2-yl]naphthalene is sourced from PubChem (CID 153192882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).