C16H19ClO — CID 162412283
(2R,3R)-1-chloro-2-naphthalen-2-ylhexan-3-ol (PubChem CID 162412283) has the molecular formula C16H19ClO and a molecular weight of 262.78 g/mol. Its IUPAC name is (2R,3R)-1-chloro-2-naphthalen-2-ylhexan-3-ol.
| Compound Name | (2R,3R)-1-chloro-2-naphthalen-2-ylhexan-3-ol |
|---|---|
| PubChem CID | 162412283 |
| Molecular Formula | C16H19ClO |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2R,3R)-1-chloro-2-naphthalen-2-ylhexan-3-ol |
| SMILES | CCC[C@@H](O)[C@H](CCl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H19ClO/c1-2-5-16(18)15(11-17)14-9-8-12-6-3-4-7-13(12)10-14/h3-4,6-10,15-16,18H,2,5,11H2,1H3/t15-,16-/m1/s1 |
| InChIKey | YKMUUMWINZLPOF-HZPDHXFCSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|