C44H48N2O2 — CID 68761263
(2S,3R)-N-methyl-3-[4-[(1R,2S)-3-(methylamino)-2-naphthalen-2-yl-1-phenylpropoxy]butoxy]-2-naphthalen-2-yl-3-phenylpropan-1-amine (PubChem CID 68761263) has the molecular formula C44H48N2O2 and a molecular weight of 636.88 g/mol. Its IUPAC name is (2S,3R)-N-methyl-3-[4-[(1R,2S)-3-(methylamino)-2-naphthalen-2-yl-1-phenylpropoxy]butoxy]-2-naphthalen-2-yl-3-phenylpropan-1-amine.
| Compound Name | (2S,3R)-N-methyl-3-[4-[(1R,2S)-3-(methylamino)-2-naphthalen-2-yl-1-phenylpropoxy]butoxy]-2-naphthalen-2-yl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 68761263 |
| Molecular Formula | C44H48N2O2 |
| Molecular Weight | 636.88 g/mol |
| Exact Mass | 636.37 |
| IUPAC Name | (2S,3R)-N-methyl-3-[4-[(1R,2S)-3-(methylamino)-2-naphthalen-2-yl-1-phenylpropoxy]butoxy]-2-naphthalen-2-yl-3-phenylpropan-1-amine |
| SMILES | CNC[C@H](c1ccc2ccccc2c1)[C@@H](OCCCCO[C@@H](c1ccccc1)[C@H](CNC)c1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C44H48N2O2/c1-45-31-41(39-25-23-33-15-9-11-21-37(33)29-39)43(35-17-5-3-6-18-35)47-27-13-14-28-48-44(36-19-7-4-8-20-36)42(32-46-2)40-26-24-34-16-10-12-22-38(34)30-40/h3-12,15-26,29-30,41-46H,13-14,27-28,31-32H2,1-2H3/t41-,42-,43+,44+/m1/s1 |
| InChIKey | OMSRAWLZSDJALM-QHQGJXSCSA-N |
| XLogP | 9.60 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.88 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|