C18H17ClN2O — CID 118675733
(1R,2R)-3-amino-1-(6-chloro-3-pyridinyl)-2-naphthalen-2-ylpropan-1-ol (PubChem CID 118675733) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is (1R,2R)-3-amino-1-(6-chloro-3-pyridinyl)-2-naphthalen-2-ylpropan-1-ol.
| Compound Name | (1R,2R)-3-amino-1-(6-chloro-3-pyridinyl)-2-naphthalen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 118675733 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (1R,2R)-3-amino-1-(6-chloro-3-pyridinyl)-2-naphthalen-2-ylpropan-1-ol |
| SMILES | NC[C@@H](c1ccc2ccccc2c1)[C@@H](O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C18H17ClN2O/c19-17-8-7-15(11-21-17)18(22)16(10-20)14-6-5-12-3-1-2-4-13(12)9-14/h1-9,11,16,18,22H,10,20H2/t16-,18-/m0/s1 |
| InChIKey | BAAMULBKWXYDRF-WMZOPIPTSA-N |
| XLogP | 3.66 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|