C9H13ClN2O2 — CID 171880722
4-amino-1-(6-chloro-3-pyridinyl)butane-1,2-diol (PubChem CID 171880722) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 4-amino-1-(6-chloro-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-amino-1-(6-chloro-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880722 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-amino-1-(6-chloro-3-pyridinyl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H13ClN2O2/c10-8-2-1-6(5-12-8)9(14)7(13)3-4-11/h1-2,5,7,9,13-14H,3-4,11H2 |
| InChIKey | WOKDILYRMOCQGT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|