C10H13ClN2O4 — CID 171881681
5-(4-amino-1,2-dihydroxybutyl)-2-chloropyridine-3-carboxylic acid (PubChem CID 171881681) has the molecular formula C10H13ClN2O4 and a molecular weight of 260.68 g/mol. Its IUPAC name is 5-(4-amino-1,2-dihydroxybutyl)-2-chloropyridine-3-carboxylic acid.
| Compound Name | 5-(4-amino-1,2-dihydroxybutyl)-2-chloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 171881681 |
| Molecular Formula | C10H13ClN2O4 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5-(4-amino-1,2-dihydroxybutyl)-2-chloropyridine-3-carboxylic acid |
| SMILES | NCCC(O)C(O)c1cnc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C10H13ClN2O4/c11-9-6(10(16)17)3-5(4-13-9)8(15)7(14)1-2-12/h3-4,7-8,14-15H,1-2,12H2,(H,16,17) |
| InChIKey | DZJBNQHTOWFCFW-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|