C11H13Cl2NO4 — CID 171894463
methyl 2-chloro-5-(4-chloro-1,2-dihydroxybutyl)pyridine-3-carboxylate (PubChem CID 171894463) has the molecular formula C11H13Cl2NO4 and a molecular weight of 294.13 g/mol. Its IUPAC name is methyl 2-chloro-5-(4-chloro-1,2-dihydroxybutyl)pyridine-3-carboxylate.
| Compound Name | methyl 2-chloro-5-(4-chloro-1,2-dihydroxybutyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 171894463 |
| Molecular Formula | C11H13Cl2NO4 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | methyl 2-chloro-5-(4-chloro-1,2-dihydroxybutyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCCl)cnc1Cl |
| InChI | InChI=1S/C11H13Cl2NO4/c1-18-11(17)7-4-6(5-14-10(7)13)9(16)8(15)2-3-12/h4-5,8-9,15-16H,2-3H2,1H3 |
| InChIKey | NJCUSFOONAXINB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|