C9H13ClN2O2 — CID 171893246
4-chloro-1-(2-methylpyrimidin-5-yl)butane-1,2-diol (PubChem CID 171893246) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 4-chloro-1-(2-methylpyrimidin-5-yl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(2-methylpyrimidin-5-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893246 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-chloro-1-(2-methylpyrimidin-5-yl)butane-1,2-diol |
| SMILES | Cc1ncc(C(O)C(O)CCCl)cn1 |
| InChI | InChI=1S/C9H13ClN2O2/c1-6-11-4-7(5-12-6)9(14)8(13)2-3-10/h4-5,8-9,13-14H,2-3H2,1H3 |
| InChIKey | RERODEKNZQKHBE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|