C8H11ClN2O2 — CID 171893201
4-chloro-1-pyrimidin-5-ylbutane-1,2-diol (PubChem CID 171893201) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is 4-chloro-1-pyrimidin-5-ylbutane-1,2-diol.
| Compound Name | 4-chloro-1-pyrimidin-5-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 171893201 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 4-chloro-1-pyrimidin-5-ylbutane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1cncnc1 |
| InChI | InChI=1S/C8H11ClN2O2/c9-2-1-7(12)8(13)6-3-10-5-11-4-6/h3-5,7-8,12-13H,1-2H2 |
| InChIKey | FCKUSJWFKBXCSG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|