C11H13ClN2O2 — CID 171893773
5-(4-chloro-1,2-dihydroxybutyl)-3-methylpyridine-2-carbonitrile (PubChem CID 171893773) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 5-(4-chloro-1,2-dihydroxybutyl)-3-methylpyridine-2-carbonitrile.
| Compound Name | 5-(4-chloro-1,2-dihydroxybutyl)-3-methylpyridine-2-carbonitrile |
|---|---|
| PubChem CID | 171893773 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 5-(4-chloro-1,2-dihydroxybutyl)-3-methylpyridine-2-carbonitrile |
| SMILES | Cc1cc(C(O)C(O)CCCl)cnc1C#N |
| InChI | InChI=1S/C11H13ClN2O2/c1-7-4-8(6-14-9(7)5-13)11(16)10(15)2-3-12/h4,6,10-11,15-16H,2-3H2,1H3 |
| InChIKey | ISDMMGIGRXOSDY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|