C9H11Cl2NO2 — CID 171893265
4-chloro-1-(6-chloro-3-pyridinyl)butane-1,2-diol (PubChem CID 171893265) has the molecular formula C9H11Cl2NO2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 4-chloro-1-(6-chloro-3-pyridinyl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(6-chloro-3-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893265 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | 4-chloro-1-(6-chloro-3-pyridinyl)butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H11Cl2NO2/c10-4-3-7(13)9(14)6-1-2-8(11)12-5-6/h1-2,5,7,9,13-14H,3-4H2 |
| InChIKey | SQWQQXFIJMJRQF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|