C8H11ClN2O2 — CID 170827531
3-amino-1-(6-chloro-3-pyridinyl)propane-1,2-diol (PubChem CID 170827531) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is 3-amino-1-(6-chloro-3-pyridinyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(6-chloro-3-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827531 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 3-amino-1-(6-chloro-3-pyridinyl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C8H11ClN2O2/c9-7-2-1-5(4-11-7)8(13)6(12)3-10/h1-2,4,6,8,12-13H,3,10H2 |
| InChIKey | PFILOQFWHCICON-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|