C7H10ClN3O2 — CID 170827505
3-amino-1-(2-chloropyrimidin-5-yl)propane-1,2-diol (PubChem CID 170827505) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 3-amino-1-(2-chloropyrimidin-5-yl)propane-1,2-diol.
| Compound Name | 3-amino-1-(2-chloropyrimidin-5-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827505 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3-amino-1-(2-chloropyrimidin-5-yl)propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C7H10ClN3O2/c8-7-10-2-4(3-11-7)6(13)5(12)1-9/h2-3,5-6,12-13H,1,9H2 |
| InChIKey | JPIAXSJKHBIANC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |